"മോർഫിൻ" എന്ന താളിന്റെ പതിപ്പുകൾ തമ്മിലുള്ള വ്യത്യാസം

വിക്കിപീഡിയ, ഒരു സ്വതന്ത്ര വിജ്ഞാനകോശം.
Content deleted Content added
No edit summary
No edit summary
വരി 1: വരി 1:

{{Drugbox
| Watchedfields = changed
| verifiedrevid = 477170110
| IUPAC_name = (5α,6α)-7,8-didehydro-<br />4,5-epoxy-17-methyl[[morphinan]]-3,6-diol
| image = Morphin - Morphine.svg
| image2 = Morphine3Dan.gif

<!--Clinical data-->
| tradename = Mscontin, Oramorph, Sevredol(Morphine as a sulfate)
| Drugs.com = {{drugs.com|monograph|morphine-sulfate}}
| pregnancy_AU = C
| pregnancy_US = C
| legal_AU = S8
| legal_CA = Schedule I
| legal_US = Schedule II
| legal_UN = N I III
| legal_status = Prescription Medicine Only
| dependency_liability = High
| routes_of_administration = [[Inhalation]] ([[smoking]]), [[Insufflation (medicine)|insufflation]] (snorting), [[oral administration|oral]], [[rectal]], [[subcutaneous]] (S.C), [[intramuscular]] (I.M), [[intravenous]] (I.V), [[epidural]], and [[intrathecal]] (I.T.)

<!--Pharmacokinetic data-->
| bioavailability = 20–40% (oral), 36–71% (rectally),<ref name="pmid3387374">{{cite journal | author = Jonsson T, Christensen CB, Jordening H, Frølund C | title = The bioavailability of rectally administered morphine | journal = Pharmacol. Toxicol. | volume = 62 | issue = 4 | pages = 203–5 |date=April 1988 | pmid = 3387374 | doi = 10.1111/j.1600-0773.1988.tb01872.x }}</ref> 100% (IV/IM)
| protein_bound = 30–40%
| metabolism = [[Hepatic]] 90%
| elimination_half-life = 2–3 h
| excretion = Renal 90%, biliary 10%

<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 57-27-2
| CAS_supplemental = <br />64-31-3 (neutral sulfate),<br />52-26-6 (hydrochloride)
| ATC_prefix = N02
| ATC_suffix = AA01
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17303
| PubChem = 5288826
| IUPHAR_ligand = 1627
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00295
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4450907
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 76I7G6D29C
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08233
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 70

<!--Chemical data-->
| C=17 | H=19 | N=1 | O=3
| molecular_weight = 285.34
| smiles = CN1CC[C@]23C4=C5C=CC(O)=C4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5
| InChI = 1/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BQJCRHHNABKAKU-KBQPJGBKSA-N
| solubility = HCl & sulf.: 60
}}
കറുപ്പിൽ നിന്നും വേർതിരിച്ചേറ്റുക്കുന്ന ശക്തിയേറിയ ഒരു മയക്കുമരുന്നും വേദനാ സംഹാരിയുമാണ് '''മോർഫിൻ'''.
കറുപ്പിൽ നിന്നും വേർതിരിച്ചേറ്റുക്കുന്ന ശക്തിയേറിയ ഒരു മയക്കുമരുന്നും വേദനാ സംഹാരിയുമാണ് '''മോർഫിൻ'''.

04:08, 22 മാർച്ച് 2014-നു നിലവിലുണ്ടായിരുന്ന രൂപം

മോർഫിൻ
Systematic (IUPAC) name
(5α,6α)-7,8-didehydro-
4,5-epoxy-17-methylmorphinan-3,6-diol
Clinical data
Trade namesMscontin, Oramorph, Sevredol(Morphine as a sulfate)
AHFS/Drugs.commonograph
Pregnancy
category
  • AU: C
  • US: C (Risk not ruled out)
Dependence
liability
High
Routes of
administration
Inhalation (smoking), insufflation (snorting), oral, rectal, subcutaneous (S.C), intramuscular (I.M), intravenous (I.V), epidural, and intrathecal (I.T.)
Legal status
Legal status
Pharmacokinetic data
Bioavailability20–40% (oral), 36–71% (rectally),[1] 100% (IV/IM)
Protein binding30–40%
MetabolismHepatic 90%
Biological half-life2–3 h
ExcretionRenal 90%, biliary 10%
Identifiers
CAS Number57-27-2 checkY
64-31-3 (neutral sulfate),
52-26-6 (hydrochloride)
ATC codeN02AA01 (WHO)
PubChemCID 5288826
IUPHAR/BPS1627
DrugBankDB00295 checkY
ChemSpider4450907 checkY
UNII76I7G6D29C checkY
KEGGD08233 checkY
ChEBICHEBI:17303 checkY
ChEMBLCHEMBL70 checkY
Chemical data
FormulaC17H19NO3
Molar mass285.34
  • CN1CC[C@]23C4=C5C=CC(O)=C4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5
  • InChI=1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1 checkY
  • Key:BQJCRHHNABKAKU-KBQPJGBKSA-N checkY
Physical data
Solubility in waterHCl & sulf.: 60 mg/mL (20 °C)
  (verify)

കറുപ്പിൽ നിന്നും വേർതിരിച്ചേറ്റുക്കുന്ന ശക്തിയേറിയ ഒരു മയക്കുമരുന്നും വേദനാ സംഹാരിയുമാണ് മോർഫിൻ.

  1. Jonsson T, Christensen CB, Jordening H, Frølund C (April 1988). "The bioavailability of rectally administered morphine". Pharmacol. Toxicol. 62 (4): 203–5. doi:10.1111/j.1600-0773.1988.tb01872.x. PMID 3387374.{{cite journal}}: CS1 maint: multiple names: authors list (link)
"https://ml.wikipedia.org/w/index.php?title=മോർഫിൻ&oldid=1930268" എന്ന താളിൽനിന്ന് ശേഖരിച്ചത്