"മോർഫിൻ" എന്ന താളിന്റെ പതിപ്പുകൾ തമ്മിലുള്ള വ്യത്യാസം
Content deleted Content added
No edit summary |
No edit summary |
||
വരി 1: | വരി 1: | ||
{{Drugbox |
|||
| Watchedfields = changed |
|||
| verifiedrevid = 477170110 |
|||
| IUPAC_name = (5α,6α)-7,8-didehydro-<br />4,5-epoxy-17-methyl[[morphinan]]-3,6-diol |
|||
| image = Morphin - Morphine.svg |
|||
| image2 = Morphine3Dan.gif |
|||
<!--Clinical data--> |
|||
| tradename = Mscontin, Oramorph, Sevredol(Morphine as a sulfate) |
|||
| Drugs.com = {{drugs.com|monograph|morphine-sulfate}} |
|||
| pregnancy_AU = C |
|||
| pregnancy_US = C |
|||
| legal_AU = S8 |
|||
| legal_CA = Schedule I |
|||
| legal_US = Schedule II |
|||
| legal_UN = N I III |
|||
| legal_status = Prescription Medicine Only |
|||
| dependency_liability = High |
|||
| routes_of_administration = [[Inhalation]] ([[smoking]]), [[Insufflation (medicine)|insufflation]] (snorting), [[oral administration|oral]], [[rectal]], [[subcutaneous]] (S.C), [[intramuscular]] (I.M), [[intravenous]] (I.V), [[epidural]], and [[intrathecal]] (I.T.) |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = 20–40% (oral), 36–71% (rectally),<ref name="pmid3387374">{{cite journal | author = Jonsson T, Christensen CB, Jordening H, Frølund C | title = The bioavailability of rectally administered morphine | journal = Pharmacol. Toxicol. | volume = 62 | issue = 4 | pages = 203–5 |date=April 1988 | pmid = 3387374 | doi = 10.1111/j.1600-0773.1988.tb01872.x }}</ref> 100% (IV/IM) |
|||
| protein_bound = 30–40% |
|||
| metabolism = [[Hepatic]] 90% |
|||
| elimination_half-life = 2–3 h |
|||
| excretion = Renal 90%, biliary 10% |
|||
<!--Identifiers--> |
|||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 57-27-2 |
|||
| CAS_supplemental = <br />64-31-3 (neutral sulfate),<br />52-26-6 (hydrochloride) |
|||
| ATC_prefix = N02 |
|||
| ATC_suffix = AA01 |
|||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 17303 |
|||
| PubChem = 5288826 |
|||
| IUPHAR_ligand = 1627 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| DrugBank = DB00295 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 4450907 |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 76I7G6D29C |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = D08233 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 70 |
|||
<!--Chemical data--> |
|||
| C=17 | H=19 | N=1 | O=3 |
|||
| molecular_weight = 285.34 |
|||
| smiles = CN1CC[C@]23C4=C5C=CC(O)=C4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5 |
|||
| InChI = 1/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1 |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = BQJCRHHNABKAKU-KBQPJGBKSA-N |
|||
| solubility = HCl & sulf.: 60 |
|||
}} |
|||
കറുപ്പിൽ നിന്നും വേർതിരിച്ചേറ്റുക്കുന്ന ശക്തിയേറിയ ഒരു മയക്കുമരുന്നും വേദനാ സംഹാരിയുമാണ് '''മോർഫിൻ'''. |
കറുപ്പിൽ നിന്നും വേർതിരിച്ചേറ്റുക്കുന്ന ശക്തിയേറിയ ഒരു മയക്കുമരുന്നും വേദനാ സംഹാരിയുമാണ് '''മോർഫിൻ'''. |
04:08, 22 മാർച്ച് 2014-നു നിലവിലുണ്ടായിരുന്ന രൂപം
Systematic (IUPAC) name | |
---|---|
(5α,6α)-7,8-didehydro- 4,5-epoxy-17-methylmorphinan-3,6-diol | |
Clinical data | |
Trade names | Mscontin, Oramorph, Sevredol(Morphine as a sulfate) |
AHFS/Drugs.com | monograph |
Pregnancy category | |
Dependence liability | High |
Routes of administration | Inhalation (smoking), insufflation (snorting), oral, rectal, subcutaneous (S.C), intramuscular (I.M), intravenous (I.V), epidural, and intrathecal (I.T.) |
Legal status | |
Legal status |
|
Pharmacokinetic data | |
Bioavailability | 20–40% (oral), 36–71% (rectally),[1] 100% (IV/IM) |
Protein binding | 30–40% |
Metabolism | Hepatic 90% |
Biological half-life | 2–3 h |
Excretion | Renal 90%, biliary 10% |
Identifiers | |
CAS Number | 57-27-2 64-31-3 (neutral sulfate), 52-26-6 (hydrochloride) |
ATC code | N02AA01 (WHO) |
PubChem | CID 5288826 |
IUPHAR/BPS | 1627 |
DrugBank | DB00295 |
ChemSpider | 4450907 |
UNII | 76I7G6D29C |
KEGG | D08233 |
ChEBI | CHEBI:17303 |
ChEMBL | CHEMBL70 |
Chemical data | |
Formula | C17H19NO3 |
Molar mass | 285.34 |
| |
| |
Physical data | |
Solubility in water | HCl & sulf.: 60 mg/mL (20 °C) |
(verify) |
കറുപ്പിൽ നിന്നും വേർതിരിച്ചേറ്റുക്കുന്ന ശക്തിയേറിയ ഒരു മയക്കുമരുന്നും വേദനാ സംഹാരിയുമാണ് മോർഫിൻ.
- ↑ Jonsson T, Christensen CB, Jordening H, Frølund C (April 1988). "The bioavailability of rectally administered morphine". Pharmacol. Toxicol. 62 (4): 203–5. doi:10.1111/j.1600-0773.1988.tb01872.x. PMID 3387374.
{{cite journal}}
: CS1 maint: multiple names: authors list (link)