"ഗ്ലൂക്കോസ്" എന്ന താളിന്റെ പതിപ്പുകൾ തമ്മിലുള്ള വ്യത്യാസം
Content deleted Content added
Luckas-bot (സംവാദം | സംഭാവനകൾ) (ചെ.) r2.7.1) (യന്ത്രം ചേർക്കുന്നു: af, ar, be, be-x-old, bg, bn, bs, ca, cs, da, de, el, eo, es, et, eu, fa, fi, fr, fy, gl, he, hi, hr, hu, id, io, is, it, ja, ka, kk, kn, ko, la, lt, lv, mk, mn, ms, nl, nn, no, oc, om |
No edit summary |
||
വരി 1: | വരി 1: | ||
{{Prettyurl|Glucose}} |
{{Prettyurl|Glucose}} |
||
{{Chembox |
|||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
|||
| verifiedrevid = 397909057 |
|||
| Name = <small>D</small>-glucose |
|||
| ImageFile1 = Glucose chain structure.svg |
|||
| ImageSize1 = 180 |
|||
| ImageCaption1 = |
|||
| ImageFile2 = D-glucose-chain-3D-balls.png |
|||
| ImageSize2 = 180 |
|||
| ImageCaption2 = |
|||
| PIN = D-glucose |
|||
| SystematicName = (2''R'',3''S'',4''R'',5''R'')-2,3,4,5,6-Pentahydroxyhexanal |
|||
| OtherNames = Blood sugar<br />Dextrose<br />Corn sugar<br /><small>D</small>-Glucose<br />Grape sugar |
|||
| Section1 = {{Chembox Identifiers |
|||
| Abbreviations = Glc |
|||
| CASNo = 50-99-7 |
|||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| PubChem = 5793 |
|||
| PubChem_Ref = {{Pubchemcite|correct|PubChem}} |
|||
| ChemSpiderID = 5589 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| UNII = 5SL0G7R0OK |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 1216 |
|||
| EINECS = 200-075-1 |
|||
| MeSHName = Glucose |
|||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 4167 |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = C00031 |
|||
| RTECS = LZ6600000 |
|||
| ATCCode_prefix = B05 |
|||
| ATCCode_suffix = CX01 |
|||
| ATC_Supplemental = V04CA02, V06DC01 |
|||
| SMILES = OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
|||
| SMILES1 = C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O)O |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1 |
|||
| InChI = 1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6+/m1/s1 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = WQZGKKKJIJFFOK-GASJEMHNSA-N |
|||
| InChIKey = WQZGKKKJIJFFOK-DVKNGEFBBQ |
|||
| Beilstein = 1281604 |
|||
| Gmelin = 83256 |
|||
| 3DMet = B04623}} |
|||
| Section2 = {{Chembox Properties |
|||
| Formula = C<sub>6</sub>H<sub>12</sub>O<sub>6</sub> |
|||
| MolarMass = 180.16 g/mol |
|||
| ExactMass = 180.063388 |
|||
| MeltingPt = α-<small>D</small>-glucose: 146 °C<br />β-<small>D</small>-glucose: 150 °C |
|||
| Density = 1.54 g/cm<sup>3</sup> |
|||
| Solubility = 91 g/100 mL |
|||
}} |
|||
| Section3 = {{Chembox Thermochemistry |
|||
| Reference = <ref>{{citation | last1 = Ponomarev | first1 = V. V. | last2 = Migarskaya | first2 = L. B. | title = Heats of combustion of some amino-acids | journal = Russ. J. Phys. Chem. (Engl. Transl.) | year = 1960 | volume = 34 | pages = 1182–83}}. {{citation | last = Boerio-Goates | first = Juliana | title = Heat-capacity measurements and thermodynamic functions of crystalline α-D-glucose at temperatures from 10K to 340K | journal = J. Chem. Thermodynam. | year = 1991 | volume = 23 | issue = 5 | pages = 403–9 | doi = 10.1016/S0021-9614(05)80128-4}}.</ref> |
|||
| DeltaHf = −1271 kJ/mol |
|||
| DeltaHc = −2805 kJ/mol |
|||
| Entropy = 209.2 J K<sup>−1</sup> mol<sup>−1</sup> |
|||
}} |
|||
| Section7 = {{Chembox Hazards |
|||
| ExternalMSDS = [http://www.inchem.org/documents/icsc/icsc/eics0865.htm ICSC 0865] |
|||
| EUIndex = not listed |
|||
}} |
|||
}} |
|||
മനുഷ്യശരീരത്തിൽ ഊർജോൽപ്പാദനത്തിന് സഹായിക്കുന്ന ഏറ്റവും ലഘുവായ [[കാർബോഹൈഡ്രേറ്റ്|കാർബോഹൈഡ്രേറ്റാണ്]] '''ഗ്ലൂക്കോസ്'''([[ഇംഗ്ലീഷ്]]: Glucose). ഇതിനെ വിഘടിപ്പിക്കുവാൻ സാധ്യമല്ല. ഇതിൽ [[ഹൈഡ്രജൻ|ഹൈഡ്രജന്റേയും]], [[ഓക്സിജൻ|ഓക്സിജന്റേയും]] [[അംശബന്ധം]] 2:1 ആണ്. |
മനുഷ്യശരീരത്തിൽ ഊർജോൽപ്പാദനത്തിന് സഹായിക്കുന്ന ഏറ്റവും ലഘുവായ [[കാർബോഹൈഡ്രേറ്റ്|കാർബോഹൈഡ്രേറ്റാണ്]] '''ഗ്ലൂക്കോസ്'''([[ഇംഗ്ലീഷ്]]: Glucose). ഇതിനെ വിഘടിപ്പിക്കുവാൻ സാധ്യമല്ല. ഇതിൽ [[ഹൈഡ്രജൻ|ഹൈഡ്രജന്റേയും]], [[ഓക്സിജൻ|ഓക്സിജന്റേയും]] [[അംശബന്ധം]] 2:1 ആണ്. |
||
05:36, 22 ഓഗസ്റ്റ് 2011-നു നിലവിലുണ്ടായിരുന്ന രൂപം
Names | |
---|---|
Preferred IUPAC name
D-glucose | |
Systematic IUPAC name
(2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanal | |
Other names
Blood sugar
Dextrose Corn sugar D-Glucose Grape sugar | |
Identifiers | |
3D model (JSmol)
|
|
3DMet | |
Abbreviations | Glc |
Beilstein Reference | 1281604 |
ChEBI | |
ChEMBL | |
ChemSpider | |
EC Number |
|
Gmelin Reference | 83256 |
KEGG | |
MeSH | {{{value}}} |
PubChem CID
|
|
RTECS number |
|
UNII | |
InChI | |
SMILES | |
Properties | |
തന്മാത്രാ വാക്യം | |
Molar mass | 0 g mol−1 |
സാന്ദ്രത | 1.54 g/cm3 |
ദ്രവണാങ്കം | |
91 g/100 mL | |
Thermochemistry | |
Std enthalpy of formation ΔfH |
−1271 kJ/mol |
Std enthalpy of combustion ΔcH |
−2805 kJ/mol |
Standard molar entropy S |
209.2 J K−1 mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
മനുഷ്യശരീരത്തിൽ ഊർജോൽപ്പാദനത്തിന് സഹായിക്കുന്ന ഏറ്റവും ലഘുവായ കാർബോഹൈഡ്രേറ്റാണ് ഗ്ലൂക്കോസ്(ഇംഗ്ലീഷ്: Glucose). ഇതിനെ വിഘടിപ്പിക്കുവാൻ സാധ്യമല്ല. ഇതിൽ ഹൈഡ്രജന്റേയും, ഓക്സിജന്റേയും അംശബന്ധം 2:1 ആണ്.
രാസസൂത്രം
- C6H12O6
ആധിക്യം വരുത്തുന്ന രോഗങ്ങൾ
പ്രമേഹം
ശരീരത്തിൽ ഗ്ലൂക്കോസിന്റെ അളവ് കൂടുതലായാൽ പ്രമേഹം വരുന്നു.
സാന്നിധ്യം തിരിച്ചറിയാനുള്ള പരീക്ഷണങ്ങൾ
ബനഡിക്ട് ലായനി ഉപയോഗിച്ച്
ടെസ്റ്റ് ട്യൂബിൽ ഏകദേശം 2മില്ലി.ലിറ്റർ ഗ്ലൂക്കോസ് ലായനി എടുക്കുന്നു. അതിലേക്ക് ഏതാനും തുള്ളി ബനഡിക്ട് ലായനി ചേർത്ത് ചൂടാക്കുമ്പോൾ പച്ച കലർന്ന മഞ്ഞ മുതൽ ചുവപ്പ് വരെ നിറം ലഭിക്കാം.
അമോണിയാക്കൽ സിൽവർ നൈട്രേറ്റ് ലായനി ഉപയോഗിച്ച്
ടെസ്റ്റ് ട്യൂബിൽ അല്പം ഗ്ലൂക്കോസ് ലായനി എടുക്കുന്നു. അതിലേക്ക് ഏതാനും തുള്ളി അമോണിയാക്കൽ സിൽവർ നൈട്രേറ്റ് ലായനി ചേർക്കുന്നു. അപ്പോൾ കറുപ്പ് നിറമുള്ള അവക്ഷിപ്തം ഉണ്ടാകുന്നു.
അവലംബം
- Text book of Organic Chemistry by Bansal