ഒലിയിക് അമ്ലം

വിക്കിപീഡിയ, ഒരു സ്വതന്ത്ര വിജ്ഞാനകോശം.
ഒലിയിക് ആസിഡ്
Oleic acid
Oleic-acid-3D-vdW.png
IUPAC നാമം (9Z)-Octadec-9-enoic acid
മറ്റു പേരുകൾ (9Z)-Octadecenoic acid
(Z)-Octadec-9-enoic acid
cis-9-Octadecenoic acid
cis9-Octadecenoic acid
Oleic acid
18:1 cis-9
Identifiers
CAS number 112-80-1
SMILES
Properties
മോളിക്യുലാർ ഫോർമുല C18H34O2
മോളാർ മാസ്സ് 282.4614 g/mol
Appearance Pale yellow or brownish yellow oily liquid with lard-like odor
സാന്ദ്രത 0.895 g/mL
ദ്രവണാങ്കം

13-14 °C (286 K)

ക്വഥനാങ്കം

360 °C (633 K) (760mm Hg)[1]

Solubility in water Insoluble
Solubility in methanol Soluble
Hazards
MSDS JT Baker
Except where noted otherwise, data are given for
materials in their standard state
(at 25 °C, 100 kPa)

Infobox references


ഗ്ലിസറൈഡ് രൂപത്തിൽ പ്രായേണ എല്ലാ എണ്ണകളിലും കൊഴുപ്പുകളിലും കണ്ടുവരുന്ന പ്രധാനപ്പെട്ട ഒരു അപൂരിത (unsaturated) ഫാറ്റി ആസിഡ് (കൊഴുപ്പംളം) ആണ് ഒലിയിക് അമ്ലം. സമം‌‌രചനാ ഫോർമുല: CH3-(CH2)7 CH-CH-(CH2)7-COOH. ഒലിവ്‌‌എണ്ണ (80%), ആൽമണ്ഡ് എണ്ണ (77%), കടല എണ്ണ (55%), എള്ളെണ്ണ (50%) എന്നിവ നല്ല ശതമാനം ഒലിയിക് ആസിഡുള്ള എണ്ണകൾക്ക് ഉദാഹരണങ്ങളാണ്.[2] പ്രകൃതിജന്യമായ ഒരു എണ്ണയുപയോഗിച്ച് ഒലിയിക് ആസിഡിനെ മറ്റുള്ള ആസിഡുകളിൽ നിന്ന് വേർതിരിച്ച് ശുദ്ധമാക്കി എടുക്കുക എന്നതു പ്രയാസമേറിയതെങ്കിലും സാധ്യമാണ്. ലവണങ്ങളുടെ ക്രിസ്റ്റലീകരണം, വളരെ താഴ്ന്ന താപത്തിൽ (-50oC പോലുള്ളത്) ആസിഡുകളുടെ ക്രിസ്റ്റലീകരണം, ക്രോമറ്റോഗ്രാഫി എന്നീ മാർഗങ്ങൾ ഇതിനുപയോഗിക്കാറുണ്ട്.[3]

ശുദ്ധമായ ഒലിയിക് ആസിഡ്[തിരുത്തുക]

ശുദ്ധമായ ഒലിയിക് ആസിഡ്, സാധാരണ താപനിലകളിൽ, നിറം, മണം, സ്വാദ് എന്നിവയില്ലാത്ത ദ്രവപദാർഥമാണ്.[4][5] വ്യാപാരികമായ ഒലിയിക് ആസിഡിൽ മറ്റു പല ഫാറ്റി അംളങ്ങളും കലർന്നിരിക്കും. വായുവിന്റെയും വെളിച്ചത്തിന്റെയും സാന്നിധ്യത്തിൽ ക്രമേണ ഇതിനു മഞ്ഞനിറവും (ചിലപ്പോൾ ചെന്തവിട്ടുനിറവും) കാറിയ മണവും ഉണ്ടാകുന്നു. ഓക്സിഡേഷൻ മൂലമാണ് ഇതു സംഭവിക്കുന്നത്. ഒലിയിക് ആസിഡ് വെള്ളത്തിൽ അലേയവും ആൽക്കഹോളിൽ ലേയവുമാണ്.[6]

രാസപ്രവർത്തനങ്ങൾ[തിരുത്തുക]

കാർബോക്സിൽ ഗ്രൂപ്പ് ഉള്ളതുകൊണ്ട് ലവണരൂപീകരണം, എസ്റ്റർ രൂപീകരണം മുതലായ പ്രതിപ്രവർത്തനങ്ങളിൽ ഒലിയിക് ആസിഡ് പങ്കെടുക്കുന്നു. സോഡിയം ഹൈഡ്രോക്സൈഡും ഒലിയിക് ആസിഡും ചേർന്നുള്ള പ്രതിപ്രവർത്തനം കൊണ്ട് സോഡിയം ഒലിയേറ്റ് എന്ന ലവണമുണ്ടാകുന്നു. എണ്ണകളിൽ നിന്ന് അലക്കുസോപ്പും കുളിസോപ്പും നിർമിക്കുമ്പോൾ ഈ ലവണമാണ് ലഭ്യമാകുന്നത്.[7]

കാർബൺ-കാർബൺ ദ്വി ബന്ധ (double bond) മുള്ളതുകൊണ്ട് ഒലിയിക് ആസിഡിൽ യോഗാത്മക (addition) പ്രതിപ്രവർത്തനങ്ങളും സാധ്യമാണ്. നിക്കൽ ഉത്പ്രേരകത്തിന്റെ സാന്നിധ്യത്തിൽ ഹൈഡ്രജനുമായി സം‌‌യോജിക്കുമ്പോൾ സ്റ്റിയറിക് ആസിഡ് കിട്ടുന്നു.

CH3-(CH2)7-CH = CH-(CH2)7-COOH+H2 --> CH3-(CH2)16-COOH

ബ്രോമിനുമായിട്ടുള്ള യോഗാത്മക - പ്രതിപ്രവനത്തിൽ നിന്ന് 9, 10 - ഡൈബ്രോമൊ സ്റ്റിയറിക് ആസിഡ് ഉണ്ടാകുന്നു.

CH3-(CH2)7-CH = CH-(CH2)7-COOH+Br2 --> CH3-(CH2)7-CHBr-CHBr-(CH2)7-COOH.

അവലംബം[തിരുത്തുക]

  1. Oleic acid, Chemical Laboratory Information Profile, American Chemical Society
  2. http://www.wisegeek.com/what-is-oleic-acid.htm What is Oleic Acid?
  3. http://en.wikipedia.org/wiki/Oleic_acid Oleic acid
  4. മലയാളം സർ‌‌വവിജ്ഞാനക്കൊശം വാല്യം - 5 പേജ് 639 കേരളാ ഗവണ്മെന്റു പ്രസിദ്ധീകരണം
  5. [1] Controlling organic acids impacts sour taste.
  6. http://www.3dchem.com/molecules.asp?ID=384 Unsaturated Fatty acid
  7. http://www.mahalo.com/oleic-acid Oleic acid

പുറംകണ്ണികൾ[തിരുത്തുക]

"http://ml.wikipedia.org/w/index.php?title=ഒലിയിക്_അമ്ലം&oldid=1840000" എന്ന താളിൽനിന്നു ശേഖരിച്ചത്