ആർ.ഡി.എക്സ്

വിക്കിപീഡിയ, ഒരു സ്വതന്ത്ര വിജ്ഞാനകോശം.

ആർ.ഡി.എക്സ് chemical structure
ആർ.ഡി.എക്സ്

1,3,5-ട്രൈനൈട്രോപെർഹൈഡ്രോ-1,3,5-ട്രയാസീൻ
1,3,5-ട്രൈനൈട്രോ-1,3,5-ട്രൈസാക്ലോഹെക്സാൻ
IUPAC name
രാസ വാക്യം C3H6N6O6
മോളാർ പിണ്ഡം 222.117 ഗ്രാം/മോൾ
Shock sensitivity കുറവ്
Friction sensitivity കുറവ്
സാന്ദ്രത 1.82 ഗ്രാം/ഘന സെമി
Explosive velocity 8,750 മീറ്ററുകൾ പ്രതി സെക്കന്റ്
RE factor 1.60
ദ്രവണാങ്കം 205.5°സെൽഷ്യസ്
സ്വയം കത്തുന്ന താപനില 234°സെൽഷ്യസ്
Appearance നിറമില്ലാത്ത ഖര ക്രിസ്റ്റലുകൾ
CAS number 121-82-4
PubChem 8490
SMILES C1N(CN(CN1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-]

സ്ഫോടനത്തിന്‌ ഉപയോഗിക്കുന്ന രാസവസ്തുവാണ്‌ ആർ.ഡി.എക്സ്. പൂർണ്ണനാമം റിസർച്ച് ഡിപ്പാർട്ട്‌മെന്റ് എക്സ്പ്ലോസീവ് പ്ലാസ്റ്റിക്

സാങ്കേതികനാമം[തിരുത്തുക]

ട്രൈനൈട്രനെൻ എന്നാണ് ഈ മാരക സ്ഫോടകവസ്തുവിൻറെ സാങ്കേതിക നാമം

രാസനാമം[തിരുത്തുക]

C_3 H_6 N_6 O_6 രാസ നാമം

രാസപദാർത്ഥം[തിരുത്തുക]

സൈക്ലൊ ട്രൈമീതലൈൻ ആണ് രാസപദാർത്ഥം

ഈ രാസപദാർത്ഥം ഒളിപ്പിച്ച് കടത്തുമ്പോൾ പ്ലാസ്റ്റിക് മെറ്റീരിയലായതു കൊണ്ട് മെറ്റൽ ഡിറ്റക്റ്ററിന് തിരിച്ചറിയാൻ കഴിയില്ല.

"http://ml.wikipedia.org/w/index.php?title=ആർ.ഡി.എക്സ്&oldid=1695932" എന്ന താളിൽനിന്നു ശേഖരിച്ചത്